Molecule 83

Chemex ID: 157
Empirical Formula: C21H25NO6
Molecular weight: 387.43 g/mol

SMILES: O=C(C1=CC(C(OCC)=O)=C(C)N(C)C1(C)C2=CC(OCO3)=C3C=C2)OCC
InChi: InChI=1S/C21H25NO6/c1-6-25-19(23)15-11-16(20(24)26-7-2)21(4,22(5)13(15)3)14-8-9-17-18(10-14)28-12-27-17/h8-11H,6-7,12H2,1-5H3
InChiKey: PABFFEBGEHDFBT-UHFFFAOYSA-N