Molecule 8

Chemex ID: 81
Empirical Formula: C30H43NO6
Molecular weight: 513.68 g/mol

SMILES: C[C@]12C(C[C@@H](OC(C)=O)CC2)=CC[C@]3([H])[C@]1([H])CC[C@@]4(C)[C@@]3([H])CC(C(OC)(OC)CC)=C4C(C#N)C(OC)=O
InChi: InChI=1S/C30H43NO6/c1-8-30(35-6,36-7)25-16-24-21-10-9-19-15-20(37-18(2)32)11-13-28(19,3)23(21)12-14-29(24,4)26(25)22(17-31)27(33)34-5/h9,20-24H,8,10-16H2,1-7H3/t20?,21-,22?,23+,24+,28+,29+/m1/s1
InChiKey: ZNQMVMUXDICDAP-RGIYVADUSA-N